Сорбитол

С Википедије, слободне енциклопедије
Сорбитол
Називи
IUPAC назив
(2S,3R,4R,5R)-Heksan-1,2,3,4,5,6-heksol
Други називи
D-глуцитол, D-Сорбитол
Идентификација
3Д модел (Jmol)
ECHA InfoCard 100.000.056
Е-бројеви Е420 (згушњивачи, ...)
МеСХ Сорбитол
  • O[C@H]([C@H](O)CO)[C@H](O)[C@@H](O)CO
Својства
C6H14O6
Моларна маса 182,17 g/mol
Густина 1,489 g/cm3
Тачка топљења 95°C
Тачка кључања 296°C
Уколико није другачије напоменуто, подаци се односе на стандардно стање материјала (на 25 °C [77 °F], 100 kPa).
ДаY верификуј (шта је ДаYНеН ?)
Референце инфокутије

Сорбитол је вишевалентни алкохол.[3][4] Природни је шећер, има енергетску вредност, па се не препоручује при дијететској исхрани, али је веома погодан код корекције укуса производа намењених дијабетичарима јер не захтева инсулин. Уз још неке природне заслађиваче као што су манитол и ксилитол и вештачки заслађивач аспартам, све се чешће примењује у прехрамбеној индустрији.

Референце[уреди | уреди извор]

  1. ^ Li Q, Cheng T, Wang Y, Bryant SH (2010). „PubChem as a public resource for drug discovery.”. Drug Discov Today. 15 (23-24): 1052—7. PMID 20970519. doi:10.1016/j.drudis.2010.10.003.  уреди
  2. ^ Еван Е. Болтон; Yанли Wанг; Паул А. Тхиессен; Степхен Х. Брyант (2008). „Цхаптер 12 ПубЦхем: Интегратед Платформ оф Смалл Молецулес анд Биологицал Ацтивитиес”. Аннуал Репортс ин Цомпутатионал Цхемистрy. 4: 217—241. дои:10.1016/С1574-1400(08)00012-1. 
  3. ^ Линдхорст, Тхисбе К. (2007). Ессентиалс оф Царбохyдрате Цхемистрy анд Биоцхемистрy (1. изд.). Wилеy-ВЦХ. ИСБН 978-3-527-31528-4. 
  4. ^ Робyт, Јохн Ф. (1997). Ессентиалс оф Царбохyдрате Цхемистрy (1. изд.). Спрингер. ИСБН 978-0-387-94951-2. 

Литература[уреди | уреди извор]

Спољашње везе[уреди | уреди извор]