Аморолфин

Из Википедије, слободне енциклопедије
Иди на навигацију Иди на претрагу

{{drugbox | IUPAC_name = (2R,6S)-2,6-dimethyl-4-{2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl}morpholine | image = Amorolfine.svg | width = | image2 = | width2 = | ChemSpiderID = 49010 | smiles = O2[C@@H](CN(CC(C)Cc1ccc(cc1)C(C)(C)CC)C[C@@H]2C)C | StdInChI_Ref =  ДаY | StdInChI = | StdInChIKey_Ref =  ДаY | StdInChIKey = | CAS_number_Ref =  ДаY | CAS_number = 78613-35-1 | ATC_prefix = D01 | ATC_suffix = AE16 | PubChem = 54260 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | DrugBank_Ref = | DrugBank = | C=21|H=35|N=1|O= | molecular_weight = 317.509 g/mol | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = }} Аморолфин је антимикотик[1] морфолинске структуре.[2] Примењује се искључиво топикално, у облику хидрохлорида, често формулисан као лак за наношење код гљивичних инфекција ноктију (онихомикоза) или као маст код дерматомикоза.[3]

Механизам дејства[уреди]

Аморолфин делује инхибицијом Δ14-редуктазе и Δ8→Δ7-изомеразе, ензима укључених у биосинтезу ергостерола. Настали метаболити структурно су другачији од ергостерола, па њихова уградња у ћелијску мембрану гљивица индукује промене у њеним особинама и нормалном функционисању транспортних механизама.[4] Показује широк спектар дејства.[5]

Извори[уреди]

  1. ^ Keith Parker; Laurence Brunton; Goodman, Louis Sanford; Lazo, John S.; Gilman, Alfred (2006). „Chapter 48. Antimicrobial agents: Antifungal agents”. Goodman & Gilman's The Pharmacological Basis of Therapeutics (11. изд.). New York: McGraw-Hill. ISBN 0071422803. 
  2. ^ Thomas L. Lemke; David A. Williams, ур. (2007). Foye's Principles of Medicinal Chemistry (6. изд.). Baltimore: Lippincott Willams & Wilkins. стр. 899. ISBN 0781768799. 
  3. ^ Porter, Robert; Beers, Mark H.; Berkow, Robert (2006). „Section 10 - Dermatologic disorders, 125. Nail disorders”. The Merck manual of diagnosis and therapy. Rahway, NJ: Merck Research Laboratories. ISBN 978-0-911910-18-6. 
  4. ^ David L. Nelson; Michael M. Cox (2005). Principles of Biochemistry (IV изд.). New York: W. H. Freeman. ISBN 0-7167-4339-6. 
  5. ^ Група аутора (2006). Ненад Угрешић, ур. Фармакотерапијски водич 3 (PDF). Београд. Архивирано (PDF) из оригинала на датум 15. 07. 2011. Приступљено 31. 05. 2010. 

Литература[уреди]

  • Група аутора (2006). Ненад Угрешић, ур. Фармакотерапијски водич 3 (PDF). Београд. Архивирано (PDF) из оригинала на датум 15. 07. 2011. Приступљено 31. 05. 2010. 
  • Porter, Robert; Beers, Mark H.; Berkow, Robert (2006). „Section 10 - Dermatologic disorders, 125. Nail disorders”. The Merck manual of diagnosis and therapy. Rahway, NJ: Merck Research Laboratories. ISBN 978-0-911910-18-6. 

Спољашње везе[уреди]

Star of life.svgМолимо Вас, обратите пажњу на важно упозорење
у вези са темама из области медицине (здравља).