Delapril

Из Википедије, слободне енциклопедије
Иди на навигацију Иди на претрагу

{{Drugbox-lat | verifiedrevid = 444593478 | IUPAC_name = 2-[(2S)-N-(2,3-dihidro-1H-inden-2-il)-2-{[(2S)-1-etoksi-1-okso-4-fenilbutan-2-il]amino}propanamido]sirćetna kiselina | image = Delapril.png

| tradename = | Drugs.com = Internacionalno ime leka | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ДаY | CAS_number = 83435-66-9 | ATC_prefix = C09 | ATC_suffix = AA12 | ATC_supplemental = | PubChem = 5362116 | DrugBank_Ref =  ДаY | DrugBank = | UNII_Ref =  ДаY | UNII = W77UAL9THI | KEGG_Ref =  ДаY | KEGG = D07781 | ChemSpiderID = 4514931 | smiles = O=C(OCC)[C@@H](N[C@H](C(=O)N(CC(=O)O)C2Cc1ccccc1C2)C)CCc3ccccc3 | StdInChI = 1S/C26H32N2O5/c1-3-33-26(32)23(14-13-19-9-5-4-6-10-19)27-18(2)25(31)28(17-24(29)30)22-15-20-11-7-8-12-21(20)16-22/h4-12,18,22-23,27H,3,13-17H2,1-2H3,(H,29,30)/t18-,23-/m0/s1 | StdInChIKey = WOUOLAUOZXOLJQ-MBSDFSHPSA-N

| chemical_formula = | C=26 | H=32 | N=2 | O=5 | molecular_weight = 452,542 g/mol }} Delapril (alindapril) je ACE inhibitor koji se koristi kao antihipertenzivni lek[1] u više zemalja u Evropi i Aziji.[2]

Reference[уреди]

  1. ^ Otero, M. L. (2007). „Manidipine-delapril combination in the management of hypertension”. Vascular health and risk management. 3 (3): 255—263. PMC 2293964Слободан приступ. PMID 17703633. 
  2. ^ Drugs.com: Delapril

Spoljašnje veze[уреди]

Star of life.svgMolimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).