
Из Википедије, слободне енциклопедије
Иди на навигацију Иди на претрагу

{{Drugbox-lat | verifiedrevid = 437139289 | IUPAC_name = 1-(2-{4-[3-(trifluorometil)fenil]piperazin-1-il}etil)-1,3-dihidro-2H-benzimidazol-2-on | image = Flibanserin-structural.svg | width = | image2 = | width2 =

| tradename = | pregnancy_category = | legal_status = Nije kontrolisan | routes_of_administration = Oralno

| bioavailability = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ДаY | CAS_number = 167933-07-5 | ATC_prefix = none | ATC_suffix = | PubChem = 6918248 | IUPHAR_ligand = | ChemSpiderID_Ref =  ДаY | ChemSpiderID = 5293454 | UNII_Ref =  ДаY | UNII = 37JK4STR6Z | KEGG_Ref =  ДаY | KEGG = D02577 | ChEMBL_Ref =  ДаY | ChEMBL = 231068 | DrugBank_Ref = | DrugBank =

| C=20 | H=21 | F=3 | N=4 | O=1 | molecular_weight = 390,40 g/mol | smiles = FC(F)(F)c4cc(N3CCN(CCN2c1ccccc1NC2=O)CC3)ccc4 | StdInChI_Ref =  ДаY | StdInChI = 1S/C20H21F3N4O/c21-20(22,23)15-4-3-5-16(14-15)26-11-8-25(9-12-26)10-13-27-18-7-2-1-6-17(18)24-19(27)28/h1-7,14H,8-13H2,(H,24,28) | StdInChIKey_Ref =  ДаY | StdInChIKey = PPRRDFIXUUSXRA-UHFFFAOYSA-N }}

Flibanserin (BIMT-17, Girosa) je lek koji je razvila kompanija Beringer Ingelhajm kao nehormonski tretman za žene pre menopoze sa poremećajem hipoaktivne seksualne želje.[1][2] Razvoj je prekinut oktobra 2010, nakon što je FDA objavila negativan izveštaj.[3]


  1. ^ Borsini F, Evans K, Jason K, Rohde F, Alexander B, Pollentier S (2002). „Pharmacology of flibanserin”. CNS Drug Rev. 8 (2): 117—142. PMID 12177684. doi:10.1111/j.1527-3458.2002.tb00219.x. 
  2. ^ Jolly E; Clayton A; Thorp J; Lewis-D’Agostino D; Wunderlich G; Lesko L (2008). „Design of Phase III pivotal trials of flibanserin in female Hypoactive Sexual Desire Disorder (HSDD)”. Sexologies. 17 (Suppl 1): S133—4. doi:10.1016/S1158-1360(08)72886-X. 
  3. ^ Spiegel online: Pharmakonzern stoppt Lustpille für die Frau, 8 October 2010 (in German)

Vidi još[уреди]

Spoljašnje veze[уреди]