Goserelin

Из Википедије, слободне енциклопедије
Иди на навигацију Иди на претрагу

{{Drugbox-lat | IUPAC_name = (2S)-1-[(2S)-2-[(2S)-2-[(2R)-3-(tert-butoksi)-2-[(2S)-2-[(2S)-3-hidroksi-2-[(2S)-2-[(2S)-3-(1H-imidazol-5-il)-2-{[(2S)-5-oksopirolidin-2-il]formamido}propanamido]-3-(1H-indol-3-il)propanamido]propanamido]-3-(4-hidroksifenil)propanamido]propanamido]-4-metilpentanamido]-5-[(diaminometiliden)amino]pentanoil]-N-(karbamoilamino)pirolidin-2-karboksamid | image = Goserelin.svg | width = | alt = | image2 = Goserelin ball-and-stick.png | width2 = | alt2 = | drug_name = Goserelin | caption =

| tradename = | Drugs.com = Monografija | MedlinePlus = | licence_EU = | licence_US = | DailyMedID = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | dependency_liability = | routes_of_administration = Subkutano

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = 4-5 sata | excretion = Brzo se uklanja iz tela kombinacijom hepatičke i urinarne ekskrecije.

| CAS_number_Ref =  ДаY | CAS_number = 65807-02-5 | CAS_supplemental = | ATCvet = | ATC_prefix = L02 | ATC_suffix = AE03 | ATC_supplemental = | PubChem = | PubChemSubstance = | IUPHAR_ligand = | DrugBank_Ref =  ДаY | DrugBank = DB00014 | ChemSpiderID_Ref =  ДаY | ChemSpiderID = | UNII_Ref =  ДаY | UNII = | KEGG_Ref =  ДаY | KEGG = | ChEBI_Ref =  ДаY | ChEBI = | ChEMBL_Ref =  ДаY | ChEMBL = | synonyms =

|C=59 |H=84 |N=18 |O=14 | molecular_weight = 1269.4105 | smiles = CC(C)C[C@H](NC(=O)[C@@H](COC(C)(C)C)NC(=O)[C@H](CC1=CC=C(O)C=C1)NC(=O)[C@H](CO)NC(=O)[C@H](CC1=CNC2=CC=CC=C12)NC(=O)[C@H](CC1=CN=CN1)NC(=O)[C@@H]1CCC(=O)N1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1C(=O)NNC(N)=O | StdInChI = 1S/C59H84N18O14/c1-31(2)22-40(49(82)68-39(12-8-20-64-57(60)61)56(89)77-21-9-13-46(77)55(88)75-76-58(62)90)69-54(87)45(29-91-59(3,4)5)74-50(83)41(23-32-14-16-35(79)17-15-32)70-53(86)44(28-78)73-51(84)42(24-33-26-65-37-11-7-6-10-36(33)37)71-52(85)43(25-34-27-63-30-66-34)72-48(81)38-18-19-47(80)67-38/h6-7,10-11,14-17,26-27,30-31,38-46,65,78-79H,8-9,12-13,18-25,28-29H2,1-5H3,(H,63,66)(H,67,80)(H,68,82)(H,69,87)(H,70,86)(H,71,85)(H,72,81)(H,73,84)(H,74,83)(H,75,88)(H4,60,61,64)(H3,62,76,90)/t38-,39-,40-,41-,42-,43-,44-,45+,46-/m0/s1 | StdInChIKey_Ref =  ДаY | StdInChI_comment = | StdInChIKey = BLCLNMBMMGCOAS-URPVMXJPSA-N | StdInChI_Ref =  ДаY | density = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | specific_rotation = | sec_combustion = }} Goserelin je sintetički hormon. Kod muškaraca, on zaustavlja produkciju hormona testosterona, koji može da stimuliše rast ćelija raka. Kod žena, goserelin snižava produkciju hormona estradiola (koji takođe može da stimuliše rast ćelija raka) na nivoe slične postmenopozalnom stanju. Nakom prestanka upotrebe leka nivoi hormona se vraćaju na normalno stanje.[1][2]

Reference[уреди]

  1. ^ Knox C, Law V, Jewison T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS (2011). „DrugBank 3.0: a comprehensive resource for omics research on drugs”. Nucleic Acids Res. 39 (Database issue): D1035—41. PMID 21059682. 
  2. ^ Wishart DS, Knox C, Guo AC, Cheng D, Shrivastava S, Tzur D, Gautam B, Hassanali M (Nucleic Acids Res) (2008). „DrugBank: a knowledgebase for drugs, drug actions and drug targets”. 36 (Database issue): D901—6. PMID 18048412. 

Spoljašnje veze[уреди]

Star of life.svgMolimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).