Karbuterol

Из Википедије, слободне енциклопедије

{{Drugbox-lat | verifiedrevid = 443941802 | IUPAC_name = (RS)-{5-[2-(tert-butilamino)-1-hidroksietil]-2-hidroksifenil}ureja | image = Carbuterol.svg | width = 200px | image2 = | width2 = | drug_name = Carbuterol

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ДаY | CAS_number = 34866-47-2 | ATC_prefix = R03 | ATC_suffix = CC10 | ATC_supplemental = | PubChem = 36976 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | DrugBank_Ref =  ДаY | DrugBank = | ChemSpiderID_Ref =  ДаY | ChemSpiderID = 33928 | UNII_Ref =  ДаY | UNII = 0N12JR32MR

| C=13 | H=21 | N=3 | O=3 | molecular_weight = 267,324 g/mol | smiles = O=C(Nc1cc(ccc1O)C(O)CNC(C)(C)C)N | StdInChI_Ref =  ДаY | StdInChI = 1S/C13H21N3O3/c1-13(2,3)15-7-11(18)8-4-5-10(17)9(6-8)16-12(14)19/h4-6,11,15,17-18H,7H2,1-3H3,(H3,14,16,19) | StdInChIKey_Ref =  ДаY | StdInChIKey = KEMXXQOFIRIICG-UHFFFAOYSA-N }} Karbuterol (karbuterol hidrohlorid) je β2-agonist.[1][2]

Reference[уреди]

  1. „Studies on carbuterol (SK&F 40383-A), a new selective bronchodilator agent”. JPET. 189: 167—184. April 1974.  Непознати параметар |coauthors= игнорисан [|author= се препоручује] (помоћ); Проверите вредност парамет(а)ра за датум: |date= (помоћ)
  2. Lunts, L. H. C.; Collin, D. T.; German Patent, 1970, DE 2032642 .

Spoljašnje veze[уреди]

Star of life.svg     Molimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).