
С Википедије, слободне енциклопедије
Иди на навигацију Иди на претрагу

{{Drugbox-lat | IUPAC_name = | image = Odanacatib Structural Formulae V.1.svg | width = | alt = | image2 = | width2 = | alt2 = | drug_name = Odanakatib | caption =

| tradename = | Drugs.com = Monografija | MedlinePlus = | licence_EU = | licence_US = | DailyMedID = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | dependency_liability = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ДаY | CAS_number = 603139-19-1 | CAS_supplemental = | ATCvet = | ATC_prefix = none | ATC_suffix = | ATC_supplemental = | PubChem = 10152654 | PubChemSubstance = | IUPHAR_ligand = | DrugBank_Ref =  ДаY | DrugBank = | ChemSpiderID_Ref =  ДаY | ChemSpiderID = 8328162 | UNII_Ref =  ДаY | UNII = N673F6W2VH | KEGG_Ref =  ДаY | KEGG = | ChEBI_Ref =  ДаY | ChEBI = | ChEMBL_Ref =  ДаY | ChEMBL = 481611 | synonyms = (2S)-N-(1-cyanocyclopropyl)-4-fluoro-4-methyl-2-{[(1S)-2,2,2-trifluoro-1-{4'-(methanesulfonyl)-[1,1'-biphenyl]-4-yl}ethyl]amino}pentanamide

|C=25 |H=27 |F=4 |N=3 |O=3 |S=1 | molecular_weight = 525,559 | smiles = CC(C)(F)C[C@H](N[C@@H](c1ccc(cc1)c2ccc(cc2)S(=O)(=O)C)C(F)(F)F)\C(=N\C3(CC3)C#N)\O | StdInChI = 1S/C25H27F4N3O3S/c1-23(2,26)14-20(22(33)32-24(15-30)12-13-24)31-21(25(27,28)29)18-6-4-16(5-7-18)17-8-10-19(11-9-17)36(3,34)35/h4-11,20-21,31H,12-14H2,1-3H3,(H,32,33)/t20-,21-/m0/s1 | StdInChIKey_Ref =  ДаY | StdInChI_comment = | StdInChIKey = FWIVDMJALNEADT-SFTDATJTSA-N | StdInChI_Ref =  ДаY | density = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | specific_rotation = | sec_combustion = }} Odanakatib je organsko jedinjenje, koje sadrži 25 atoma ugljenika i ima molekulsku masu od 525,559 Da.

Osobine[уреди | уреди извор]

Osobina Vrednost
Broj akceptora vodonika 6
Broj donora vodonika 2
Broj rotacionih veza 10
Particioni koeficijent[1] (ALogP) 4,7
Rastvorljivost[2] (logS, log(mol/L)) -8,9
Polarna površina[3] (PSA, Å2) 110,9

Reference[уреди | уреди извор]

Literatura[уреди | уреди извор]

Spoljašnje veze[уреди | уреди извор]