Proglumetacin

Из Википедије, слободне енциклопедије
Иди на навигацију Иди на претрагу

{{Drugbox-lat | verifiedrevid = 400862995 | IUPAC_name = 3-{4-[2-({[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetyl}oxy)ethyl]piperazin-1-yl}propyl N2-benzoyl-N,N-dipropyl-α-glutaminate |synonyms = 3-[4-[2-[2-[1-(4-hlorobenzoil)-5-metoksi-2-metilindol-3-il]acetil]oksietil]piperazin-1-il]propil 4-(benzoilamino)-5-(dipropilamino)-5-oksopentanoat | image = Proglumetacin.svg | width = | image2 = | width2 = | ChemSpiderID_Ref =  ДаY | ChemSpiderID = 4752 | smiles = Clc1ccc(cc1)C(=O)n3c2ccc(OC)cc2c(c3C)CC(=O)OCCN4CCN(CC4)CCCOC(=O)CCC(C(=O)N(CCC)CCC)NC(=O)c5ccccc5 | StdInChI_Ref =  ДаY | StdInChI = 1S/C46H58ClN5O8/c1-5-21-51(22-6-2)46(57)40(48-44(55)34-11-8-7-9-12-34)18-20-42(53)59-29-10-23-49-24-26-50(27-25-49)28-30-60-43(54)32-38-33(3)52(41-19-17-37(58-4)31-39(38)41)45(56)35-13-15-36(47)16-14-35/h7-9,11-17,19,31,40H,5-6,10,18,20-30,32H2,1-4H3,(H,48,55) | StdInChIKey_Ref =  ДаY | StdInChIKey = PTXGHCGBYMQQIG-UHFFFAOYSA-N | CAS_number_Ref =  ДаY | CAS_number = 57132-53-3 | CAS_supplemental = 59209-40-4 (maleat) | ATC_prefix = M01 | ATC_suffix = AB14 | PubChem = 4921 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | DrugBank_Ref = | DrugBank = | C=46|H=58|Cl=1|N=5|O=8 | molecular_weight = 844.43442 g/mol | bioavailability = | protein_bound = | metabolism = Hepatički | elimination_half-life = | excretion = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = }} Proglumetacin (Afloksan, Protakson i Proksil) je ne-steroidni antiinflamatorni lek. On se metabolizuje u telu do indometacina i proglumida,[1] leka sa antisekretornim dejstvom koji pomaže u sprečavanju povreda sluzokože želuca. Proglumetacin se obično koristi u obliku maleatnih soli.

Literatura[уреди]

  1. ^ Setnikar I, Arigoni R, Chisté R, Makovec F, Revel L (1987). „Plasma levels of proglumetacin and its metabolites after intravenous or oral administration in the dog”. Arzneimittel-Forschung. 37 (6): 698—702. PMID 3663267. 

Spoljašnje veze[уреди]

Star of life.svgMolimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).