Rescinamin

Из Википедије, слободне енциклопедије

{{Drugbox-lat | verifiedrevid = 464380960 | IUPAC_name = metil (3β,16β,17α,18β,20α)-11,17-dimetoksi-18-{[(2E)-3-(3,4,5-trimetoksifenil)prop-2-enoil]oksi}johimban-16-karboksilat | image = Rescinnamine.svg | width = 300 | image2 = | width2 =

| tradename = | pregnancy_category = | legal_status = Rx-only | routes_of_administration = oralno

| bioavailability = | protein_bound = | metabolism = | elimination_half-life =

| CAS_number_Ref =  ДаY | CAS_number = 24815-24-5 | ATC_prefix = C02 | ATC_suffix = AA01 | ATC_supplemental = | PubChem = 5280954 | IUPHAR_ligand = | DrugBank_Ref =  ДаY

| DrugBank = DB01180

| ChemSpiderID_Ref =  ДаY | ChemSpiderID = 4444446 | UNII_Ref =  ДаY | UNII = Q6W1F7DJ2D | KEGG_Ref =  ДаY | KEGG = D00198 | ChEBI_Ref =  ДаY | ChEBI = 28572 | ChEMBL_Ref =  ДаY | ChEMBL = 1668

| C=35 | H=42 | N=2 | O=9 | molecular_weight = 634,716 g/mol | smiles = O=C(OC)[C@H]6[C@H]4C[C@@H]3c2nc1cc(OC)ccc1c2CCN3C[C@H]4C[C@@H](OC(=O)\C=C\c5cc(OC)c(OC)c(OC)c5)[C@@H]6OC | StdInChI_Ref =  ДаY | StdInChI = 1S/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/b10-7+/t20-,24+,26-,29-,31+,34+/m1/s1 | StdInChIKey_Ref =  ДаY | StdInChIKey = SZLZWPPUNLXJEA-QEGASFHISA-N | synonyms = metil (1R,15S,17R,18R,19S,20S)-6,18-dimetoksi-17[(2E)-3-(3,4,5-trimetoksifenil)prop-2-enoil]oksi3,13-diazapentaciklo[11.8.0.02,10.04,9.015,20]henikosa-2(10),4(9),5,7-tetraen-19-karboksilat }} Rescinnamin je Inhibitor angiotenzin konvertujućeg enzima koji se koristi kao antihipertenziv.

On je vinka alkaloid koji se dobija iz biljke Rauwolfia serpentina[1] i drugih Rauwolfia vrsta.[2]

On je dostupan pod trgovačkim imenima: Moderil, Cinnasil, Anaprel.

Reference[уреди]

  1. FIFE R, MACLAURIN JC, WRIGHT JH (1960). „Rescinnamine in treatment of hypertension in hospital clinic and in general practice”. British Medical Journal. 2 (5216): 1848—50. PMC 2098607Слободан приступ. PMID 13699407. doi:10.1136/bmj.2.5216.1848. 
  2. Balsevich J, Constabel F, Kurz WG (1982). „Alkaloids of Vinca major cv. Variegata.”. Planta Med. 44 (2): 91—3. PMID 17402086. 

Spoljašnje veze[уреди]

Star of life.svg     Molimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).