Tafluprost

Из Википедије, слободне енциклопедије

{{Drugbox-lat | IUPAC_name = izopropil -{(5Z)-7(1R,2R,3R,5S)-2-[(1E)-3,3-difluoro-4-fenoksibut-1-en-1-il]-3,5-dihidroksiciklopentil}hept-5-enoat | image = Tafluprost_structure.svg | width = | image2 = | width2 =

| tradename = Saflutan, Taflotan, Tapros, Zioptan | Drugs.com = Internacionalno ime leka | pregnancy_AU = | pregnancy_US = C | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = Rx-only | legal_status = | routes_of_administration = Topikalni (kapi za oči)

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ДаY | CAS_number = 209860-87-7 | ATC_prefix = S01 | ATC_suffix = EE05 | ATC_supplemental = | PubChem = 6433101 | IUPHAR_ligand = | ChEMBL_Ref = | ChEBI_Ref =  ДаY | ChEBI = 66899 | DrugBank = | ChEMBL = 1963683 | DrugBank_Ref = | ChemSpiderID = 8044182 | UNII_Ref =  ДаY | UNII = 1O6WQ6T7G3

| chemical_formula = | C=25 | H=34 | F=2 | O=5 | molecular_weight = 452,531266 g/mol | smiles = CC(C)OC(=O)CCC\C=C/CC(C(O)CC1O)C1\C=C\C(F)(F)COc2ccccc2 | StdInChI_Ref =  ДаY | StdInChI = | StdInChIKey_Ref =  ДаY | StdInChIKey = }}

Tafluprost (Taflotan, Zioptan) je prostaglandinski analog koji se koristi topikalno (kao kapi za oči) za kontrolu progresa glaukoma i okularne hipertenzije. On redukuju intraokularni pritisak tako što povećava odliv fluida iz očiju.[1][2]

Reference[уреди]

  1. Schubert-Zsilavecz, M, Wurglics, M, Neue Arzneimittel 2008/2009
  2. Santen Home Page

Spoljašnje veze[уреди]

Star of life.svg     Molimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).