Folinska kiselina

С Википедије, слободне енциклопедије
Пређи на навигацију Пређи на претрагу

{{Drugbox-lat | Verifiedfields = | verifiedrevid = 470454241 | IUPAC_name = (2S)-2-{[4-[(2-amino-5-formil-4-okso-5,6,7,8-
benzoil]amino}pentanedionska kiselina | image = Folinic acid.svg | width = | image2 = | width2 =

| tradename = | = Монографија | pregnancy_AU = A | pregnancy_US = C | legal_status = Rx-only | routes_of_administration = Intravenozno, oralno

| bioavailability = zavisno od doze | protein_bound = ~15% | metabolism = | elimination_half-life = 6,2 sata | excretion = Urinarno

| CAS_number_Ref =  ДаY | CAS_number = 1492-18-8 | ATC_prefix = V03 | ATC_suffix = AF03 | PubChem = 6006 | IUPHAR_ligand = | DrugBank_Ref =  НеН

| DrugBank = DB00650

| ChemSpiderID_Ref =  ДаY | ChemSpiderID = 5784 | UNII_Ref =  ДаY | UNII = RPR1R4C0P4 | ChEMBL_Ref =  ДаY | ChEMBL = 1679

| C=20 | H=23 | N=7 | O=7 | molecular_weight = 473,44 g/mol | smiles = O=C(O)[C@@H](NC(=O)c1ccc(cc1)NCC3N(/C2=C(/N/C(=N\C2=O)N)NC3)C=O)CCC(=O)O | StdInChI_Ref =  ДаY | StdInChI = 1S/C20H23N7O7/c21-20-25-16-15(18(32)26-20)27(9-28)12(8-23-16)7-22-11-3-1-10(2-4-11)17(31)24-13(19(33)34)5-6-14(29)30/h1-4,9,12-13,22H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,23,25,26,32)/t12?,13-/m0/s1 | StdInChIKey_Ref =  ДаY | StdInChIKey = VVIAGPKUTFNRDU-ABLWVSNPSA-N }}

Levofolinska kiselina

Folinska kiselina (leukovorin) je pomoćni lek koji se koristi u hemoterapiji kancera primenom leka metotreksata.[1] Foliniska kiselina se generalno dozira kao kalcijum ili natrijum folinat (ili leukovorin kalcijum/natrijum). Ona se takođe koristi u kombinaciji sa hemoterapijskim agensom 5-fluorouracil.

Levofolininska kiselina i njene soli su enantiočisti lekovi (u ovom slučaju, levo forma). Oni su biološki aktivna forma folinske kiseline.

Foliniska kiselina je okrivena 1948. kao citrovorum faktor i povremeno se još uvek koristi pod tim imenom.[2] Folinska kiselina se razlikuje od folne kiseline (Vitamina B9). Folinska kiselina je provitamin folne kiseline, i ima punu aktivnost tog vitamina.

Reference[уреди | уреди извор]

Spoljašnje veze[уреди | уреди извор]

Star of life.svgMolimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).