
Из Википедије, слободне енциклопедије
Иди на навигацију Иди на претрагу

{{Drugbox-lat | verifiedrevid = 477861448 | IUPAC_name = 2-(4-{[4-metil-6-(1-metil-1H-1,3-benzodiazol-2-il)-2-propil-1H-1,3-benzodiazol-1-il]metil}fenil)benzojeva kiselina | image = Telmisartan.png | width = 180

| tradename = Micardis | = Monografija | MedlinePlus = a601249 | pregnancy_category = D (Au), D (U.S.) | legal_status = S4 (Au), POM (UK), ℞-only (SAD) | routes_of_administration = Oralno

| bioavailability = 42–100% | protein_bound = ≥99,5% | metabolism = Minimalan hepatički | elimination_half-life = 24 sata | excretion = Fekalno 97%

| CAS_number_Ref =  ДаY | CAS_number = 144701-48-4 | ATC_prefix = C09 | ATC_suffix = CA07 | PubChem = 65999 | IUPHAR_ligand = 592 | DrugBank_Ref =  ДаY

| DrugBank = DB00966

| ChemSpiderID_Ref =  ДаY | ChemSpiderID = 59391 | UNII_Ref =  ДаY | UNII = U5SYW473RQ | KEGG_Ref =  ДаY | KEGG = D00627 | ChEBI_Ref =  ДаY | ChEBI = 9434 | ChEMBL_Ref =  ДаY | ChEMBL = 1017

| C=33 | H=30 | N=4 | O=2 | molecular_weight = 514,617 g/mol | smiles = O=C(O)c1ccccc1c2ccc(cc2)Cn3c4cc(cc(c4nc3CCC)C)c5nc6ccccc6n5C | StdInChI_Ref =  ДаY | StdInChI = 1S/C33H30N4O2/c1-4-9-30-35-31-21(2)18-24(32-34-27-12-7-8-13-28(27)36(32)3)19-29(31)37(30)20-22-14-16-23(17-15-22)25-10-5-6-11-26(25)33(38)39/h5-8,10-19H,4,9,20H2,1-3H3,(H,38,39) | StdInChIKey_Ref =  ДаY | StdInChIKey = RMMXLENWKUUMAY-UHFFFAOYSA-N }} Telmisartan je antagonist angiotenzin II receptora (blokator angiotenzinskog receptora, ARB) koji se koristi u tretmanu hipertenzije. On je u prodaji pod imenom Micardis (kompanija Boehringer Ingelheim), između ostalog.


Telmisartan je indiciran za tratman hipertenzije.[1]

Vidi još[уреди]


  1. ^ Telmisartan
Star of life.svgMolimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).