Lisinopril

Из Википедије, слободне енциклопедије
Иди на навигацију Иди на претрагу

{{drugbox-lat | Verifiedfields = | Watchedfields = | drug_name = Lisinopril | caption = Chemical structure of lisinopril | verifiedrevid = 432833853 | IUPAC_name = N2-[(1S)-1-karboksi-3-fenilpropil]-L-lizil-L-prolin | image = Lisinopril Structural Formulae V.2.svg

| tradename = Prinivil, Tensopril, Zestril, Hipril | Drugs.com = Monografija | MedlinePlus = a692051 | pregnancy_category = C (prvo tromesečje ) / D (drugo i treće tromesečje )[1] | legal_status = Rx-only | routes_of_administration = Oralno

| bioavailability = oko 25% | protein_bound = 0 | metabolism = None | elimination_half-life = 12 sata | excretion = Eliminiše se nepromenje u urinu

| CAS_number = 83915-83-7 | ChemSpiderID_Ref =  ДаY | ChemSpiderID = 4514933 | ATC_prefix = C09 | ATC_suffix = AA03 | ATC_supplemental = | ChEBI_Ref =  ДаY | ChEBI = 43755 | PubChem = 5362119 | DrugBank_Ref =  ДаY | DrugBank = APRD00560 | KEGG_Ref =  ДаY | KEGG = D00362 | ChEMBL_Ref =  ДаY | ChEMBL = 1237 |synonyms = (2S)-1-[(2S)-6-amino-2-{[(1S)-1-karboksi-3-fenilpropil]amino}heksanoil]pirolidin-2-karboksilna kiselina | UNII_Ref =  ДаY | UNII = 7Q3P4BS2FD

| C=21 | H=31 | N=3 | O=5 | molecular_weight = 405,488 g/mol | smiles = O=C(O)[C@H]2N(C(=O)[C@@H](N[C@H](C(=O)O)CCc1ccccc1)CCCCN)CCC2 | StdInChI_Ref =  ДаY | StdInChI = 1S/C21H31N3O5/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/t16-,17-,18-/m0/s1 | StdInChIKey_Ref =  ДаY | StdInChIKey = RLAWWYSOJDYHDC-BZSNNMDCSA-N }} Lisinopril je lek klase inhibitora angiotenzin konvertujućeg enzima (ACE). On se prvenstveno koristi u tretmanu hipertenzije, zatajenja srca, i srčanog udara, kao i za sprečavanje renalnih i retinalnih komplikacija uzrokovanih dijabetesom. Njegove indikacije, kontraindikacije i nuspojave su tipične za sve ACE inhibitore.

Istorijski, lisinopril je bio treći ACE inhibitor (nakon kaptoprila i enalaprila) i uveden je u upotrebu tokm ranih 1990-tih.[2]

Osobine[уреди]

Osobina Vrednost
Broj akceptora vodonika 7
Broj donora vodonika 4
Broj rotacionih veza 12
Particioni koeficijent[3] (ALogP) -3,7
Rastvorljivost[4] (logS, log(mol/L)) -4,2
Polarna površina[5] (PSA, Å2) 132,9

Reference[уреди]

  1. ^ „Lisinopril”. The American Society of Health-System Pharmacists. Приступљено 3. 4. 2011. 
  2. ^ Patchett A, Harris E, Tristram E, Wyvratt M, Wu M, Taub D, Peterson E, Ikeler T, ten Broeke J, Payne L, Ondeyka D, Thorsett E, Greenlee W, Lohr N, Hoffsommer R, Joshua H, Ruyle W, Rothrock J, Aster S, Maycock A, Robinson F, Hirschmann R, Sweet C, Ulm E, Gross D, Vassil T, Stone C (1980). „A new class of angiotensin-converting enzyme inhibitors”. Nature. 288 (5788): 280—3. PMID 6253826. doi:10.1038/288280a0. 
  3. ^ Ghose, A.K.; Viswanadhan V.N. & Wendoloski, J.J. (1998). „Prediction of Hydrophobic (Lipophilic) Properties of Small Organic Molecules Using Fragment Methods: An Analysis of AlogP and CLogP Methods”. J. Phys. Chem. A. 102: 3762—3772. doi:10.1021/jp980230o. 
  4. ^ Tetko IV, Tanchuk VY, Kasheva TN, Villa AE (2001). „Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices”. Chem Inf. Comput. Sci. 41: 1488—1493. PMID 11749573. doi:10.1021/ci000392t.  уреди
  5. ^ Ertl P.; Rohde B.; Selzer P. (2000). „Fast calculation of molecular polar surface area as a sum of fragment based contributions and its application to the prediction of drug transport properties”. J. Med. Chem. 43: 3714—3717. PMID 11020286. doi:10.1021/jm000942e.  уреди

Literatura[уреди]

Vidi još[уреди]

Spoljašnje veze[уреди]

Star of life.svgMolimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).