Koenzim B

С Википедије, слободне енциклопедије
Koenzim B
Coenzyme B (CoB).svg
IUPAC naziv
2-[(7-merkapto-1-oksoheptil)amino]-3-fosfonooksibutanska kiselina
3D model (Jmol)
  • O=C(N[C@@H](C(=O)O)[C@H](OP(=O)(O)O)C)CCCCCCS
Molarna masa 343,333641
Ukoliko nije drugačije napomenuto, podaci se odnose na standardno stanje materijala (na 25°C [77°F], 100 kPa).
ДаY verifikuj (šta je ДаYНеН ?)
Reference infokutije

Koenzim B je koenzim koji je neophodan za redoks reakije u metanogenima. Puno hemijski naziv koenzima B je 7-merkaptoheptanoiltreoninfosfat.[3] Ovaj molekul sadrži tiol, koji je glavno mesto reakcije.

Koenzim B reaguje sa 2-metiltioetansulfonatom (metil-koenzimom M, skraćeno CH
), pri čemu se formira metan u metanogenezi:[4]

+ HS–CoB → CH
+ CoB–S–S–CoM

Ovu konverziju katalizuje enzim metil koenzim M reduktaza, koja sadrži kofaktor F430 kao prostetičku grupu.

Srodna konverzija koja koristi HS-CoB i HS-CoM je redukcija fumarata do sukcinata, katalizovana fumarat reduktazom:[5]

+ HS–CoB O
+ CoB–S–S–CoM

Reference[уреди | уреди извор]

  1. ^ Li Q, Cheng T, Wang Y, Bryant SH (2010). „PubChem as a public resource for drug discovery.”. Drug Discov Today. 15 (23-24): 1052—7. PMID 20970519. doi:10.1016/j.drudis.2010.10.003.  уреди
  2. ^ Evan E. Bolton; Yanli Wang; Paul A. Thiessen; Stephen H. Bryant (2008). „Chapter 12 PubChem: Integrated Platform of Small Molecules and Biological Activities”. Annual Reports in Computational Chemistry. 4: 217—241. doi:10.1016/S1574-1400(08)00012-1. 
  3. ^ Noll KM, Rinehart KL, Tanner RS, Wolfe RS (1986). „Structure of component B (7-mercaptoheptanoylthreonine phosphate) of the methylcoenzyme M methylreductase system of Methanobacterium thermoautotrophicum”. Proc. Natl. Acad. Sci. U.S.A. 83 (12): 4238—42. PMC 323707Слободан приступ. PMID 3086878. doi:10.1073/pnas.83.12.4238. 
  4. ^ Thauer RK (1998). „Biochemistry of methanogenesis: a tribute to Marjory Stephenson. 1998 Marjory Stephenson Prize Lecture”. Microbiology. 144 (Pt 9): 2377—406. PMID 9782487. doi:10.1099/00221287-144-9-2377. Архивирано из оригинала на датум 17. 05. 2020. Приступљено 07. 12. 2012. 
  5. ^ Heim S, Künkel A, Thauer RK, Hedderich R (1998). „Thiol:fumarate reductase (Tfr) from Methanobacterium thermoautotrophicum—identification of the catalytic sites for fumarate reduction and thiol oxidation”. Eur. J. Biochem. 253 (1): 292—9. PMID 9578488. doi:10.1046/j.1432-1327.1998.2530292.x. 

Spoljašnje veze[уреди | уреди извор]