
Из Википедије, слободне енциклопедије
Иди на навигацију Иди на претрагу

{{Drugbox-lat | Verifiedfields = | verifiedrevid = 378676793 | IUPAC_name = N-[3-(1H-imidazol-4-il)-propil]-N'-(2-{[(4-methil-1H-imidazol-5-il)metil]tio}etil)guanidin | image = Impromidine.svg | width = | image2 = | width2 =

| tradename = | routes_of_administration =

| CAS_number_Ref =  ДаY | CAS_number = 55273-05-7 | ATC_prefix = none | ATC_suffix = | PubChem = 41376 | IUPHAR_ligand = 1226 | DrugBank_Ref =  ДаY | DrugBank = | UNII_Ref =  ДаY | UNII = 931L4X5WMM | ChEMBL_Ref =  ДаY | ChEMBL = 12608

| C=14 | H=23 | N=7 | S=1 | molecular_weight = 321,44 g/mol | smiles = Cc2ncnc2CSCCNC(N)=NCCCc1cncn1 | StdInChI_Ref =  ДаY | StdInChI = | StdInChIKey_Ref =  ДаY | StdInChIKey = }} Impromidin (INN) je visoko potentan i specifičan agonist histaminskog H2 receptora.[1]

On se koristi u dijagnostici kao indikator gastričke sekrecije.


  1. ^ Durant G, Duncan W, Ganellin C, Parsons M, Blakemore R, Rasmussen A (1978). „Impromidine (SK&F 92676) is a very potent and specific agonist for histamine H2 receptors”. Nature. 276 (5686): 403—5. doi:10.1038/276403a0. PMID 714166. 

Vidi još[уреди]

Spoljašnje veze[уреди]

Star of life.svgMolimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).