Metilfenidat — разлика између измена

С Википедије, слободне енциклопедије
Интерактиван преглед историје
← Старија изменаНовија измена →
Садржај обрисан Садржај додат
ВизуелноВикитекст
м corrected template
.
Ред 65: Ред 65:
== Literatura ==
== Literatura ==
{{refbegin}}
{{refbegin}}
* {{cite news |author=Gardiner Harris |title=F.D.A. Finds Short Supply of Attention Deficit Drugs |newspaper=The New York Times |date = 3. 2. 2012. |url=http://www.nytimes.com/2012/01/01/health/policy/fda-is-finding-attention-drugs-in-short-supply.html?pagewanted=all |quote=(Archived by WebCite® at [http://www.webcitation.org/65BMsEdx2]) |archiveurl=http://www.webcitation.org/query?url=http%3A%2F%2Fwww.nytimes.com%2F2012%2F01%2F01%2Fhealth%2Fpolicy%2Ffda-is-finding-attention-drugs-in-short-supply.html%3Fpagewanted%3Dall&date = 3. 2. 2012. |archivedate = 3. 2. 2012. |accessdate = 3. 2. 2012. |ref=NYTShortage}}
* {{cite news |author=Gardiner Harris |title=F.D.A. Finds Short Supply of Attention Deficit Drugs |newspaper=The New York Times |date = 3. 2. 2012. |url=http://www.nytimes.com/2012/01/01/health/policy/fda-is-finding-attention-drugs-in-short-supply.html?pagewanted=all |quote=(Archived by WebCite® at [http://www.webcitation.org/65BMsEdx2]) |archive-url=http://www.webcitation.org/query?url=http%3A%2F%2Fwww.nytimes.com%2F2012%2F01%2F01%2Fhealth%2Fpolicy%2Ffda-is-finding-attention-drugs-in-short-supply.html%3Fpagewanted%3Dall |archivedate = 3. 2. 2012. |accessdate = 3. 2. 2012. |ref=NYTShortage}}
⚫
* {{Cite journal|author=Lakhan SE, Hagger-Johnson GE |title=The impact of prescribed psychotropics on youth |journal=Clin Pract Epidemol Ment Health |volume=3 |page=21 |year=2007 |pmid=17949504 |pmc=2100041 |doi=10.1186/1745-0179-3-21 |url=http://www.cpementalhealth.com/content/3/1/21 |issue=1}}
* {{cite news |author=L. Alan Sroufe |title=Ritalin Gone Wrong - Opinion - Children\'s A.D.D.Drugs Don\'t Work Long-Term |newspaper=The New York Times |archivedate = 3. 2. 2012. |url=http://www.nytimes.com/2012/01/29/opinion/sunday/childrens-add-drugs-dont-work-long-term.html |accessdate = 3. 2. 2012. |quote=(Archived by WebCite® at [http://www.webcitation.org/65BMZA2Ac]) |archiveurl=http://www.webcitation.org/query?url=http%3A%2F%2Fwww.nytimes.com%2F2012%2F01%2F29%2Fopinion%2Fsunday%2Fchildrens-add-drugs-dont-work-long-term.html&date = 3. 2. 2012. |ref=NYTGoneWrong |date = 28. 1. 2012.}}
⚫
* {Cite journal|author=Lakhan SE, Hagger-Johnson GE |title=The impact of prescribed psychotropics on youth |journal=Clin Pract Epidemol Ment Health |volume=3 |page=21 |year=2007 |pmid=17949504 |pmc=2100041 |doi=10.1186/1745-0179-3-21 |url=http://www.cpementalhealth.com/content/3/1/21 |issue=1}}
* -{Drug Enforcement Administration, Greene, S.H., Response to CHADD petition concerning Ritalin, 1995, August 7. Washington, DC: DEA, U.S. Department of Justice.}-
* -{Drug Enforcement Administration, Greene, S.H., Response to CHADD petition concerning Ritalin, 1995, August 7. Washington, DC: DEA, U.S. Department of Justice.}-
* [http://www.nih.gov/news/pr/sept98/nida-29.htm New Research Helps Explain Ritalin's Low Abuse Potential When Taken As Prescribed – 09/29/1998]. Nih.gov. Retrieved on 2011-04-30.
* [http://www.nih.gov/news/pr/sept98/nida-29.htm New Research Helps Explain Ritalin's Low Abuse Potential When Taken As Prescribed – 09/29/1998]. Nih.gov. Retrieved on 2011-04-30.
Ред 75: Ред 74:
| series = Joan Hamburg Show (Radio)
| series = Joan Hamburg Show (Radio)
| credits = Presenters: Joan Hamburg and Dr. Harold Koplewicz
| credits = Presenters: Joan Hamburg and Dr. Harold Koplewicz

| network = WOR Radio Network
| network = WOR Radio Network
| station = WOR
| station = WOR
| city = [[New York]], [[Њујорк (држава)|NY]]
| location = [[New York]], [[Њујорк (држава)|NY]]
| airdate = 3. 2. 2012.
| airdate = 3. 2. 2012.
| minutes = 1:11 into the complete two part show - 2
| minutes = 1:11 into the complete two part show - 2 }}
| transcripturl=http://wor710.com/topic/play_window.php?audioType=Episode&audioId=5670191 }}</ref>
{{refend}}
{{refend}}


Верзија на датум 30. октобар 2017. у 05:12

Metilfenidat
IUPAC ime
metil fenil(piperidin-2-il)acetat
Klinički podaci
Prodajno imeConcerta, Methylin, Ritalin, Equasym XL
Drugs.comMonografija
MedlinePlusa682188
Podaci o licenci
Kategorija trudnoće
  • AU: B3
  • US: C (Mogući rizik)
Opojna drogaModerate
Način primeneOralno, transdermalno
Pravni status
Pravni status
Farmakokinetički podaci
Bioraspoloživost~30% (opseg: 11–52%)
Vezivanje proteina10-33%
MetabolizamHepatički (80%)
Poluvreme eliminacije3-4 sata (d-enantiomer), 1-3 sata (l-enantiomer)
IzlučivanjeUrin (90%)
Identifikatori
CAS broj113-45-1 ДаY
ATC kodN06BA04 (WHO)
PubChemCID 4158
DrugBankDB00422 ДаY
ChemSpider4015 ДаY
UNII207ZZ9QZ49 ДаY
KEGGD04999 ДаY
ChEBICHEBI:6887 ДаY
ChEMBLCHEMBL796 ДаY
Hemijski podaci
FormulaC14H19NO2
Molarna masa233,30 g/mol
  • O=C(OC)C(C1CCCCN1)C2=CC=CC=C2
  • InChI=1S/C14H19NO2/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3 ДаY
  • Key:DUGOZIWVEXMGBE-UHFFFAOYSA-N ДаY
Fizički podaci
Tačka topljenja214 °C (417 °F)

Metilfenidat (Concerta, Methylin, Ritalin, Equasym XL) je psihostimulišući lek i supstituisani fenetilamin koji je odobren tretman hiperkinetičkog poremećaja (ADHD), posturalnog ortostatskog tahikardnog sindroma i narkolepsije. Originalni patent je posedovalo preduzeće CIBA. FDA je odobrila ovaj lek 1955. za tretiranje hiperaktivnosti. Propisivan je od početka 1960-tih. Nivo proskripcija je znatno porastao tokom 1990-tih kad je ADHD dijagnoza postala šire prihvaćena.[1][2]

Reference

  1. ^ When Was Ritalin Invented?, citing Lawrence Diller: "Running on Ritalin", 1999
  2. ^ Lange, K.W. et al.: The history of attention deficit hyperactivity disorder. In: Attention Deficit Hyperactivity Disorders, 2(4):241-55. doi: 10.1007/s12402-010-0045-8.

Literatura

Spoljašnje veze

Metilfenidat na Vikimedijinoj ostavi.
Преузето из „https://sr.wikipedia.org/w/index.php?title=Metilfenidat&oldid=15590908”