
С Википедије, слободне енциклопедије
Пређи на навигацију Пређи на претрагу

{{Drugbox-lat | IUPAC_name = 2-{4-[(2S)-2-(3,4-dimetoksifenil)-2-hidroksietil]piperazin-1-il}ciklohepta-2,4,6-trien-1-on | image = Ciladopa.png | width = | image2 = | width2 =

| tradename = | pregnancy_category = | legal_status = nije kontrolisana supstanca | routes_of_administration = Oralno

| bioavailability = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ДаY | CAS_number = 80109-27-9 | ATC_prefix = none | ATC_suffix = | PubChem = 133371 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | DrugBank_Ref = | DrugBank = | ChemSpiderID = 117659 | UNII_Ref =  ДаY | UNII = D09L486R3J

| C=21 | H=26 | N=2 | O=4 | molecular_weight = 370,44 g/mol | smiles = O=C3/C=C\C=C/C=C3/N2CCN(C[C@@H](O)c1ccc(OC)c(OC)c1)CC2 | StdInChI_Ref =  ДаY | StdInChI = | StdInChIKey_Ref =  ДаY | StdInChIKey = }}

Ciladopa (AY-27,110) je dopaminski agonist sa sličnom hemijskom strukturom sa dopaminom.[1] On je bio ispitivan kao mogući antiparkinsonski agens, ali su dalja ispitivanja prekinuta zbog moguće tumorogeneze.[2][3][4][5]

Reference[уреди | уреди извор]

  1. ^ Voith, K (1985). „The comparative long-term effects of ciladopa (AY-27,110), a chemically novel dopaminergic agonist, in 6-OHDA-lesioned and intact rats”. Psychopharmacology. 85 (4): 405—9. PMID 3927334. doi:10.1007/BF00429654. 
  2. ^ Koller WC, Fields JZ, Gordon JH, Perlow MJ (1986). „Evaluation of ciladopa hydrochloride as a potential anti-Parkinson drug”. Neuropharmacology. 25 (9): 973—9. PMID 3774130. doi:10.1016/0028-3908(86)90190-5. 
  3. ^ Weiner WJ, Factor SA, Sanchez-Ramos J, Berger J (1987). „A double-blind evaluation of ciladopa in Parkinson's disease”. Movement Disorders : Official Journal of the Movement Disorder Society. 2 (3): 211—7. PMID 3332914. doi:10.1002/mds.870020308. 
  4. ^ Lieberman A, Gopinathan G, Neophytides A, Pasternack P, Goldstein M (1987). „Advanced Parkinson's disease: use of partial dopamine agonist, ciladopa”. Neurology. 37 (5): 863—5. PMID 3574692. 
  5. ^ Lang, AE (1987). „Update on dopamine agonists in Parkinson's disease: "beyond bromocriptine"”. The Canadian Journal of Neurological Sciences. Le Journal Canadien Des Sciences Neurologiques. 14 (3 Suppl): 474—82. PMID 3315148. 

Spoljašnje veze[уреди | уреди извор]