Mosaprid

Из Википедије, слободне енциклопедије

{{Drugbox-lat | Verifiedfields = | verifiedrevid = 462255663 | IUPAC_name = (RS)-4-amino-5-hloro-2-etoksi-N-{[4-(4-fluorobenzil)morfolin-2-il]metil}benzamid | image = Mosapride.png | width = 180 | image2 = 3D Mosapride.png | width2 =

| tradename = | Drugs.com = Internacionalno ime leka | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ДаY | CAS_number = 112885-41-3 | ATC_prefix = none | ATC_suffix = | PubChem = 119584 | IUPHAR_ligand = 242 | DrugBank_Ref =  ДаY | DrugBank = | ChemSpiderID_Ref =  ДаY | ChemSpiderID = 106780 | UNII_Ref =  ДаY | UNII = I8MFJ1C0BY | KEGG_Ref =  ДаY | KEGG = D08236 | ChEMBL_Ref =  ДаY | ChEMBL = 60889

| C=21 | H=25 | Cl=1 | F=1 | N=3 | O=3 | molecular_weight = 421,893 g/mol | smiles = Clc1cc(c(OCC)cc1N)C(=O)NCC3OCCN(Cc2ccc(F)cc2)C3 | StdInChI_Ref =  ДаY | StdInChI = 1S/C21H25ClFN3O3/c1-2-28-20-10-19(24)18(22)9-17(20)21(27)25-11-16-13-26(7-8-29-16)12-14-3-5-15(23)6-4-14/h3-6,9-10,16H,2,7-8,11-13,24H2,1H3,(H,25,27) | StdInChIKey_Ref =  ДаY | StdInChIKey = YPELFRMCRYSPKZ-UHFFFAOYSA-N | synonyms = }} Mosaprid je gastroprokinetički agens koji deluje kao selektivni 5HT4 agonist[1] koji ubrzava gastrično pražnjenje i koristi se za tretman kiselinskog refluksa[2], sindroma iritabilnih creva i funkcionalnu dispepsiju.[3] Njegova česta sporedna dejstva su dijareja, abdomenalni bol, vrtoglavica, konstipacija, glavobolja, insomnija, i mučnina.[4]

Reference[уреди]

  1. Kato S, Morie T, Yoshida N. Synthesis and biological activities of metabolites of mosapride, a new gastroprokinetic agent. Chemical and Pharmaceutical Bulletin (Tokyo). 1995 Apr;43(4):699-702.
  2. Ruth M, Hamelin B, Rohss K, Lundell L. The effect of mosapride, a novel prokinetic, on acid reflux variables in patients with gastro-oesophageal reflux disease. Alimentary Pharmacology and Therapeutics. 1998 Jan;12(1):35-40.
  3. Mizuta Y, Shikuwa S, Isomoto H, Mishima R, Akazawa Y, Masuda J, Omagari K, Takeshima F, Kohno S. Recent insights into digestive motility in functional dyspepsia. Journal of Gastroenterology. 2006 Nov;41(11):1025-40.
  4. Mosapride drug information - Drugs Update India

Spoljašnje veze[уреди]