
Из Википедије, слободне енциклопедије
Иди на навигацију Иди на претрагу

{{Drugbox-lat | verifiedrevid = 457287206 | IUPAC_name = 2-{3-[4-(3-hlorofenil)piperazin-1-il]propil}[1,2,4]triazolo[4,3-a]piridin-3(2H)-on | image = Trazodone.svg | width = | image2 = Trazodone-from-HCl-xtal-3D-balls.png | width2 =

| tradename = | = Monografija | MedlinePlus = a681038 | pregnancy_US = C | legal_status = Rx-only | routes_of_administration = Oralno

| bioavailability = visoka | metabolism = Hepatički | elimination_half-life = 3-6 sata | excretion = 20% izmet,
80% urin

| CAS_number_Ref =  ДаY | CAS_number = 19794-93-5 | ATC_prefix = N06 | ATC_suffix = AX05 | PubChem = 5533 | IUPHAR_ligand = 213 | DrugBank_Ref =  ДаY

| DrugBank = DB00656

| ChemSpiderID_Ref =  ДаY | ChemSpiderID = 5332 | UNII_Ref =  ДаY | UNII = YBK48BXK30 | KEGG_Ref =  ДаY | KEGG = D08626 | ChEBI_Ref =  ДаY | ChEBI = 9654 | ChEMBL_Ref =  ДаY | ChEMBL = 621

| C=19 | H=22 | Cl=1 | N=5 | O=1 | molecular_weight = 371,864 g/mol | smiles = Clc4cccc(N3CCN(CCCN1/N=C2/C=C\C=C/N2C1=O)CC3)c4 | StdInChI_Ref =  ДаY | StdInChI = 1S/C19H22ClN5O/c20-16-5-3-6-17(15-16)23-13-11-22(12-14-23)8-4-10-25-19(26)24-9-2-1-7-18(24)21-25/h1-3,5-7,9,15H,4,8,10-14H2 | StdInChIKey_Ref =  ДаY | StdInChIKey = PHLBKPHSAVXXEF-UHFFFAOYSA-N }}

Trazodon (Desorel, Oleptro, Benefikat, Depraks, Desirel, Molipaksin, Tombran, Trazorel, Trialodin, Tritiko, i Mesirel) je antidepresiv iz klase serotoninskih antagonista i inhibitora preuzimanja. On je fenilpiperazinsko jedinjenje. Trazodon je isto tako anksiolitik i hipnotik.[1] Trazodon ima znatno manje izražene nuspojave koje su karakteristične za triciklične antidepresive.


Jedan od sintetičkih puteva je:[2][3]

Trazodone synthesis.png


  1. ^ Haria M, Fitton A, McTavish D (1994). „Trazodone. A review of its pharmacology, therapeutic use in depression and therapeutic potential in other disorders”. Drugs Aging. 4 (4): 331—55. PMID 8019056. doi:10.2165/00002512-199404040-00006. 
  2. ^ Palazzo, G.; Silvestrini, B.; 1968, U.S. Patent 3.381.009.
  3. ^ B. Silvestrini, G. Palazzo, DE 164594 

Vidi još[уреди]

Spoljašnje veze[уреди]