
Из Википедије, слободне енциклопедије
Jump to navigation Jump to search

{{Drugbox-lat | verifiedrevid = 443383199 | IUPAC_name =(RS)-N-{3-[1-hidroksi-2-(metilamino)etil]fenil}metanesulfonamid | image = Amidephrine.svg | width = | image2 = | width2 =

| tradename = | pregnancy_category = | legal_status = | routes_of_administration =

| bioavailability = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ДаY | CAS_number = 3354-67-4 | ATC_prefix = none | ATC_suffix = | PubChem = 15010 | IUPHAR_ligand = 514 | ChemSpiderID_Ref =  ДаY | ChemSpiderID = 14288 | UNII_Ref =  ДаY | UNII = 7E2P22546V | ChEMBL_Ref =  ДаY | ChEMBL = 146408 | DrugBank_Ref = | DrugBank =

| C=10 | H=16 | N=2 | O=3 | S=1 | molecular_weight = 244,31 g/mol | smiles = O=S(=O)(Nc1cc(ccc1)C(O)CNC)C | StdInChI_Ref =  ДаY | StdInChI = 1S/C10H16N2O3S/c1-11-7-10(13)8-4-3-5-9(6-8)12-16(2,14)15/h3-6,10-13H,7H2,1-2H3 | StdInChIKey_Ref =  ДаY | StdInChIKey = ZHOWHMXTJFZXRB-UHFFFAOYSA-N }}

Amidefrin je alfa-adrenergički agonist.[1]
