
С Википедије, слободне енциклопедије
Пређи на навигацију Пређи на претрагу

{{Drugbox-lat | Verifiedfields = | verifiedrevid = 412885041 | IUPAC_name = metil (RS)-3-{4-[2-hidroksi-3-(propan-2-ilamino)propoksi]fenil}propanoat | image = Esmolol structure.svg | width = | image2 = | width2 =

| tradename = | = Monografija | pregnancy_AU = C | pregnancy_US = C | pregnancy_category = | legal_status = | routes_of_administration = IV

| bioavailability = - | protein_bound = 60% | metabolism = Eritrociti | elimination_half-life = 9 minuta | excretion = Renalno

| CAS_number_Ref =  ДаY | CAS_number = 103598-03-4 | ATC_prefix = C07 | ATC_suffix = AB09 | PubChem = 59768 | IUPHAR_ligand = | DrugBank_Ref =  ДаY | DrugBank = DB00187 | ChemSpiderID_Ref =  ДаY | ChemSpiderID = 53916 | UNII_Ref =  ДаY | UNII = MDY902UXSR | KEGG_Ref =  ДаY | KEGG = D07916 | ChEBI_Ref =  ДаY | ChEBI = 4856 | ChEMBL_Ref =  ДаY | ChEMBL = 768

| C=16 | H=25 | N=1 | O=4 | molecular_weight = 295,374 g/mol | smiles = O=C(OC)CCc1ccc(OCC(O)CNC(C)C)cc1 | StdInChI_Ref =  ДаY | StdInChI = 1S/C16H25NO4/c1-12(2)17-10-14(18)11-21-15-7-4-13(5-8-15)6-9-16(19)20-3/h4-5,7-8,12,14,17-18H,6,9-11H2,1-3H3 | StdInChIKey_Ref =  ДаY | StdInChIKey = AQNDDEOPVVGCPG-UHFFFAOYSA-N }} Esmolol (Brevibloc) je kardioselektivni blokator beta1 receptora sa brzim početkom dejstva,[1] i veoma kratkim trajanjem. On nema značajno intrinsično simpatomimetično ili membransko stabilišuće dejstvo pri terapeutskim dozama. On je antiaritmik iz klase II.[2]

Reference[уреди | уреди извор]

  1. ^ Deng CY; Lin SG; Zhang WC; et al. (2006). „Esmolol inhibits Na+ current in rat ventricular myocytes”. Methods Find Exp Clin Pharmacol. 28 (10): 697—702. PMID 17235414. doi:10.1358/mf.2006.28.10.1037498. 
  2. ^ Jaillon P, Drici M (1989). „Recent antiarrhythmic drugs”. Am. J. Cardiol. 64 (20): 65J—69J. PMID 2688391. doi:10.1016/0002-9149(89)91203-4. 

Spoljašnje veze[уреди | уреди извор]

Star of life.svgMolimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).