
С Википедије, слободне енциклопедије
Иди на навигацију Иди на претрагу

{{Drugbox-lat | verifiedrevid = 459442789 | IUPAC_name = (RS)-4-(2-{[4-(4-hidroksifenil)butan-2-il]amino}etil)benzen-1,2-diol | image = Dobutamine skeletal.svg | width = | image2 = | width2 = | drug_name = Dobutamin

| tradename = | = Monografija | MedlinePlus = a682861 | pregnancy_category = B | legal_status = Rx-only | routes_of_administration = Intravenozno

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = 2 minuta

| CAS_number_Ref =  ДаY | CAS_number = 34368-04-2 | ATC_prefix = C01 | ATC_suffix = CA07 | ATC_supplemental = | PubChem = 36811 | IUPHAR_ligand = 535 | DrugBank_Ref =  ДаY

| DrugBank = DB00841

| ChemSpiderID_Ref =  ДаY | ChemSpiderID = 33786 | UNII_Ref =  ДаY | UNII = 0WR771DJXV | KEGG_Ref =  ДаY | KEGG = D03879 | ChEBI_Ref =  ДаY | ChEBI = 4670 | ChEMBL_Ref =  ДаY | ChEMBL = 926

| C=18 | H=23 | N=1 | O=3 | molecular_weight = 301,38 g/mol | smiles = Oc1ccc(cc1O)CCNC(C)CCc2ccc(O)cc2 | StdInChI_Ref =  ДаY | StdInChI = 1S/C18H23NO3/c1-13(2-3-14-4-7-16(20)8-5-14)19-11-10-15-6-9-17(21)18(22)12-15/h4-9,12-13,19-22H,2-3,10-11H2,1H3 | StdInChIKey_Ref =  ДаY | StdInChIKey = JRWZLRBJNMZMFE-UHFFFAOYSA-N | synonyms = Dobutrex, Inotrex }} Dobutamin je simpatomimetik koji se koristi u tretmanu zatajenja srca i kardiogenog šoka. Njegov primarni mehanizam je direktna stimulacija β1 receptora simpatičkog nervnog sistema. Ilaj Lili end kompani je razvila dobutamin. On je strukturni analog izoprenalina.[1]

Hemija[уреди | уреди извор]

On se može sintetisati reakcijom 2-(3,4-dimetoksifenil)etanamina i 1-(4-metoksifenil)-3-butanona, gde se simultanom redukcijom formira imin. Metoksilna zaštitna grupa ovog intermedijara se uklanja bromovodonikom, te se formira dobutamin.[2][3]

Dobutamine synthesis.png

Reference[уреди | уреди извор]

  1. ^ Tuttle RR, Mills J (1975). „Dobutamine: development of a new catecholamine to selectively increase cardiac contractility”. Circ Res. 36 (1): 185—96. PMID 234805. doi:10.1161/01.RES.36.1.185. 
  2. ^ R. R. Tuttle, J. Mills, DE 2317710  (1973)
  3. ^ J. Mills, R. R. Tuttle, U.S. Patent 3.987.200 (1976)

Spoljašnje veze[уреди | уреди извор]

Star of life.svgMolimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).