
С Википедије, слободне енциклопедије
Пређи на навигацију Пређи на претрагу

{{Drugbox-lat | Watchedfields = | verifiedrevid = 458476745 | IUPAC_name = (RS)-2-{4-[2-Hidroksi-3-(propan-2-ilamino)propoksi]fenil}acetamid | image = Atenolol.svg | width = 200 | image2 = Atenolol_3d_structure.png | width2 = 200 | drug_name = Atenolol

| tradename = Tenormin | = Monografija | MedlinePlus = a684031 | licence_US = Atenolol | pregnancy_AU = C | pregnancy_US = D | legal_status = Rx-only | routes_of_administration = Oralno ili IV

| bioavailability = 40-50% | protein_bound = 6-16% | metabolism = Hepatički <10% | elimination_half-life = 6-7 sata | excretion = Renalno

| CAS_number_Ref =  ДаY | CAS_number = 29122-68-7 | ATC_prefix = C07 | ATC_suffix = AB03 | PubChem = 2249 | IUPHAR_ligand = 548 | DrugBank_Ref =  ДаY

| DrugBank = DB00335

| ChemSpiderID_Ref =  ДаY | ChemSpiderID = 2162 | UNII_Ref =  ДаY | UNII = 50VV3VW0TI | KEGG_Ref =  ДаY | KEGG = D00235 | ChEBI_Ref =  ДаY | ChEBI = 2904 | ChEMBL_Ref =  ДаY | ChEMBL = 24

| C=14 | H=22 | N=2 | O=3 

| molecular_weight = 266,336 g/mol | smiles = O=C(N)Cc1ccc(OCC(O)CNC(C)C)cc1 | StdInChI_Ref =  ДаY | StdInChI = 1S/C14H22N2O3/c1-10(2)16-8-12(17)9-19-13-5-3-11(4-6-13)7-14(15)18/h3-6,10,12,16-17H,7-9H2,1-2H3,(H2,15,18) | StdInChIKey_Ref =  ДаY | StdInChIKey = METKIMKYRPQLGS-UHFFFAOYSA-N }}

Atenolol (u Srbiji poznat pod zaštićenim nazivom Prinorm) je selektivni antagonist β1 receptor. Ovaj lek pripada grupi beta blokatora (β-blokatora). Ta klasa lekova se prvenstveno koristi za kardiovaskularne bolesti. Uveden je 1976. Atenolol je razvijen kao zamena za propranolol u tretmanu hipertenzije. Ovaj lek deluje putem usporavanja srca i redukovanja njegovog opteraćenja. Za razliku od propranolola, atenolol ne prolazi kroz krvno–moždanu barijeru, čime se izbegavaju razne nuspojave u centralnom nervnom sistemu.[1]

Reference[уреди | уреди извор]

  1. ^ Agon P, Goethals P, Van Haver D, Kaufman JM (1991). „Permeability of the blood–brain barrier for atenolol studied by positron emission tomography”. J. Pharm. Pharmacol. 43 (8): 597—600. PMID 1681079. doi:10.1111/j.2042-7158.1991.tb03545.x. 

Spoljašnje veze[уреди | уреди извор]

Star of life.svgMolimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).