
С Википедије, слободне енциклопедије
Пређи на навигацију Пређи на претрагу

{{Drugbox-lat | verifiedrevid = 444541801 | IUPAC_name = (±)-4,4'-{heksan-1,6-diilbis[imino(1-hidroksietan-2,1-diil)]}dibenzen-1,2-diol | image = Hexoprenaline.png | width = 200px | image2 = | width2 = | drug_name = Heksoprenalin

| tradename = | Drugs.com = Internacionalno ime leka | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ДаY | CAS_number = 3215-70-1 | ATC_prefix = R03 | ATC_suffix = AC06 | ATC_supplemental = R03CC05 | PubChem = 3609 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | DrugBank_Ref =  ДаY | DrugBank = | UNII_Ref =  ДаY | UNII = G9L6B3W684

| chemical_formula = | C=22 | H=32 | N=2 | O=6 | molecular_weight = 420,499 g/mol | smiles = C1=CC(=C(C=C1C(CNCCCCCCNCC(C2=CC(=C(C=C2)O)O)O)O)O)O | StdInChI_Ref =  ДаY | StdInChI = | StdInChIKey_Ref =  ДаY | StdInChIKey = | synonyms = 4-[2-[6-([2-(3,4-dihidroksifenil)-2-hidroksietil]amino)heksilamino]-1-hidroksietil]benzen-1,2-diol }}

Heksoprenalin je agonist β2-adrenergičkog receptora koji se koristi za tretmant astme.[1]

Reference[уреди | уреди извор]

  1. ^ Pinder, RM; Brogden, RN; Speight, TM; Avery, GS (1977). „Hexoprenaline: a review of its pharmacological properties and therapeutic efficacy with particular reference to asthma”. Drugs. 14 (1): 1—28. PMID 195789. 

Spoljašnje veze[уреди | уреди извор]

Star of life.svgMolimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).