Bufenin

Из Википедије, слободне енциклопедије

{{Drugbox-lat | IUPAC_name = 4-{1-hidroksi-2-[(1-metil-3-fenilpropil)amino]propil}fenol | image = Buphenine.png | width = | image2 = | width2 =

| tradename = | Drugs.com = Internacionalno ime leka | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ДаY | CAS_number = 447-41-6 | ATC_prefix = C04 | ATC_suffix = AA02 | ATC_supplemental = G02CA02 | PubChem = 4567 | IUPHAR_ligand = | DrugBank = | ChemSpiderID = 4407 | UNII_Ref =  ДаY | UNII = 695DKH33EI | ChEMBL_Ref =  ДаY | ChEMBL = 114655 | DrugBank_Ref =

| C=19 | H=25 | N=1 | O=2 | molecular_weight = 299,41 g/mol | smiles = OC(c1ccc(O)cc1)C(NC(C)CCc2ccccc2)C | StdInChI_Ref =  ДаY | StdInChI = | StdInChIKey_Ref =  ДаY | StdInChIKey = }}

Bufenin (nilidrin) je beta-adrenergički agonist[1] koji deluje kao vazodilatator putem beta-2 receptora.

Reference[уреди]

  1. Mittag TW, Tormay A, Messenger M, Podos SM (1985). „Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin”. Invest. Ophthalmol. Vis. Sci. 26 (2): 163—9. PMID 2857689. 

Spoljašnje veze[уреди]

Star of life.svg     Molimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).