
С Википедије, слободне енциклопедије
Пређи на навигацију Пређи на претрагу

{{Drugbox-lat | Verifiedfields = | Watchedfields = | verifiedrevid = 470632689 | IUPAC_name = (RS)-N-(2-{[2-hidroksi-3-(4-hidroksifenoksi)propil]amino}etil)morfolin-4-karboksamid | image = xamoterol.png | width = | image2 = | width2 =

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ДаY | CAS_number = 81801-12-9 | ATC_prefix = C01 | ATC_suffix = CX07 | PubChem = 155774 | IUPHAR_ligand = 538 | DrugBank_Ref =  ДаY | DrugBank = | ChemSpiderID_Ref =  ДаY | ChemSpiderID = 137213 | UNII_Ref =  ДаY | UNII = 7HE0JQL703 | KEGG_Ref =  ДаY | KEGG = D06328 | ChEMBL_Ref =  ДаY | ChEMBL = 75753

| C=16 | H=25 | N=3 | O=5 | molecular_weight = 339,387 g/mol | smiles = O=C(NCCNCC(O)COc1ccc(O)cc1)N2CCOCC2 | StdInChI_Ref =  ДаY | StdInChI = 1S/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22) | StdInChIKey_Ref =  ДаY | StdInChIKey = DXPOSRCHIDYWHW-UHFFFAOYSA-N }}

Ksamoterol je srčani stimulans. On deluje putem vezivanja za β1 adrenergički receptor. On je treća generacija parcijalnih agonista andrenergičkih beta receptora. On pruža srčanu stimulaciju kad pacijent miruje i deluje kao blokator tokom vežbanja.[1]

Reference[уреди | уреди извор]

  1. ^ Rang, H. P. (2003). Pharmacology. Edinburgh: Churchill Livingstone. ISBN 0-443-07145-4.  Page 163

Literatura[уреди | уреди извор]

Spoljašnje veze[уреди | уреди извор]

Star of life.svgMolimo Vas, obratite pažnju na važno upozorenje
u vezi sa temama iz oblasti medicine (zdravlja).