Befunolol
{{Drugbox-lat | Watchedfields = | verifiedrevid = 413883923 | IUPAC_name = (RS)-1-{7-[2-hidroksi-3-(propan-2-ilamino)propoksi]- 1-benzofuran-2-il}etanon | image = Befunolol.svg | width = | image2 = | width2 =
| tradename = Benfuran, Bentos, Betaclar, Glauconex | Drugs.com = Internacionalno ime leka | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US =
| legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = | CAS_number = 39552-01-7 | ATC_prefix = S01 | ATC_suffix = ED06 | PubChem = 2309 | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 2219 | UNII_Ref = | UNII = 418546MT3A | KEGG_Ref = | KEGG = D07496 | ChEMBL_Ref = | ChEMBL = 153984
| C=16 | H=21 | N=1 | O=4 | molecular_weight = 291,342 g/mol | smiles = O=C(c2oc1c(OCC(O)CNC(C)C)cccc1c2)C | StdInChI_Ref = | StdInChI = 1S/C16H21NO4/c1-10(2)17-8-13(19)9-20-14-6-4-5-12-7-15(11(3)18)21-16(12)14/h4-7,10,13,17,19H,8-9H2,1-3H3 | StdInChIKey_Ref = | StdInChIKey = ZPQPDBIHYCBNIG-UHFFFAOYSA-N }} Befunolol je beta blokator sa intrinsičnom simpatomimetičkom aktivnošću koji se koristi u tretmanu glaukoma.[1]
Reference[uredi | uredi izvor]
- ^ Stephan Reichl, Christel C Müller-Goymann (2. 1. 2003). „The use of a porcine organotypic cornea construct for permeation studies from formulations containing befunolol hydrochloride”. International Journal of Pharmaceutics. 250 (1): 191—201.